C29H58 — CID 154603547
(8R)-2,4,4,6,6,10,10,12,12,14,14-undecamethyl-8-propan-2-ylpentadec-1-ene (PubChem CID 154603547) has the molecular formula C29H58 and a molecular weight of 406.78 g/mol. Its IUPAC name is (8R)-2,4,4,6,6,10,10,12,12,14,14-undecamethyl-8-propan-2-ylpentadec-1-ene.
| Compound Name | (8R)-2,4,4,6,6,10,10,12,12,14,14-undecamethyl-8-propan-2-ylpentadec-1-ene |
|---|---|
| PubChem CID | 154603547 |
| Molecular Formula | C29H58 |
| Molecular Weight | 406.78 g/mol |
| Exact Mass | 406.45 |
| IUPAC Name | (8R)-2,4,4,6,6,10,10,12,12,14,14-undecamethyl-8-propan-2-ylpentadec-1-ene |
| SMILES | C=C(C)CC(C)(C)CC(C)(C)C[C@@H](CC(C)(C)CC(C)(C)CC(C)(C)C)C(C)C |
| InChI | InChI=1S/C29H58/c1-22(2)16-26(8,9)20-27(10,11)17-24(23(3)4)18-28(12,13)21-29(14,15)19-25(5,6)7/h23-24H,1,16-21H2,2-15H3/t24-/m0/s1 |
| InChIKey | SRSFJCODQICZTK-DEOSSOPVSA-N |
| XLogP | 10.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.78 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|