C20H40 — CID 163753121
2,4,4,6,6,8,8,10,10-nonamethylundec-1-ene (PubChem CID 163753121) has the molecular formula C20H40 and a molecular weight of 280.54 g/mol. Its IUPAC name is 2,4,4,6,6,8,8,10,10-nonamethylundec-1-ene.
| Compound Name | 2,4,4,6,6,8,8,10,10-nonamethylundec-1-ene |
|---|---|
| PubChem CID | 163753121 |
| Molecular Formula | C20H40 |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 280.31 |
| IUPAC Name | 2,4,4,6,6,8,8,10,10-nonamethylundec-1-ene |
| SMILES | C=C(C)CC(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C20H40/c1-16(2)12-18(6,7)14-20(10,11)15-19(8,9)13-17(3,4)5/h1,12-15H2,2-11H3 |
| InChIKey | LRTLZGBMHJQZRD-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|