C12H26Cl+ — CID 140547290
2,4,4,6,6-pentamethylheptan-2-ylchloranium (PubChem CID 140547290) has the molecular formula C12H26Cl+ and a molecular weight of 205.79 g/mol. Its IUPAC name is 2,4,4,6,6-pentamethylheptan-2-ylchloranium.
| Compound Name | 2,4,4,6,6-pentamethylheptan-2-ylchloranium |
|---|---|
| PubChem CID | 140547290 |
| Molecular Formula | C12H26Cl+ |
| Molecular Weight | 205.79 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | 2,4,4,6,6-pentamethylheptan-2-ylchloranium |
| SMILES | CC(C)(C)CC(C)(C)CC(C)(C)[ClH+] |
| InChI | InChI=1S/C12H26Cl/c1-10(2,3)8-11(4,5)9-12(6,7)13/h13H,8-9H2,1-7H3/q+1 |
| InChIKey | XIPJITITOOYZAE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|