C17H34V — CID 159855533
2,3,4,4,6,6,8,8-octamethylnon-2-ene;vanadium (PubChem CID 159855533) has the molecular formula C17H34V and a molecular weight of 289.40 g/mol. Its IUPAC name is 2,3,4,4,6,6,8,8-octamethylnon-2-ene;vanadium.
| Compound Name | 2,3,4,4,6,6,8,8-octamethylnon-2-ene;vanadium |
|---|---|
| PubChem CID | 159855533 |
| Molecular Formula | C17H34V |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.21 |
| IUPAC Name | 2,3,4,4,6,6,8,8-octamethylnon-2-ene;vanadium |
| SMILES | CC(C)=C(C)C(C)(C)CC(C)(C)CC(C)(C)C.[V] |
| InChI | InChI=1S/C17H34.V/c1-13(2)14(3)17(9,10)12-16(7,8)11-15(4,5)6;/h11-12H2,1-10H3; |
| InChIKey | NQMCQUFXEUWKGI-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|