C34H64 — CID 59939112
1-(2,4,4-trimethylpentan-2-yl)-2-(2,4,4,5,6,7,7,9,9,10,11-undecamethyldodeca-5,10-dien-2-yl)cyclopropane (PubChem CID 59939112) has the molecular formula C34H64 and a molecular weight of 472.89 g/mol. Its IUPAC name is 1-(2,4,4-trimethylpentan-2-yl)-2-(2,4,4,5,6,7,7,9,9,10,11-undecamethyldodeca-5,10-dien-2-yl)cyclopropane.
| Compound Name | 1-(2,4,4-trimethylpentan-2-yl)-2-(2,4,4,5,6,7,7,9,9,10,11-undecamethyldodeca-5,10-dien-2-yl)cyclopropane |
|---|---|
| PubChem CID | 59939112 |
| Molecular Formula | C34H64 |
| Molecular Weight | 472.89 g/mol |
| Exact Mass | 472.50 |
| IUPAC Name | 1-(2,4,4-trimethylpentan-2-yl)-2-(2,4,4,5,6,7,7,9,9,10,11-undecamethyldodeca-5,10-dien-2-yl)cyclopropane |
| SMILES | CC(C)=C(C)C(C)(C)CC(C)(C)C(C)=C(C)C(C)(C)CC(C)(C)C1CC1C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C34H64/c1-23(2)24(3)30(9,10)21-31(11,12)25(4)26(5)32(13,14)22-34(17,18)28-19-27(28)33(15,16)20-29(6,7)8/h27-28H,19-22H2,1-18H3 |
| InChIKey | SEZKSIBPAAQVRI-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.89 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|