C16H21FN4S2 — CID 131888863
1-(4-fluorophenyl)-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]piperidin-4-amine (PubChem CID 131888863) has the molecular formula C16H21FN4S2 and a molecular weight of 352.50 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]piperidin-4-amine.
| Compound Name | 1-(4-fluorophenyl)-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 131888863 |
| Molecular Formula | C16H21FN4S2 |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]piperidin-4-amine |
| SMILES | Cc1nnc(SCCNC2CCN(c3ccc(F)cc3)CC2)s1 |
| InChI | InChI=1S/C16H21FN4S2/c1-12-19-20-16(23-12)22-11-8-18-14-6-9-21(10-7-14)15-4-2-13(17)3-5-15/h2-5,14,18H,6-11H2,1H3 |
| InChIKey | DSGUACIWZVWTOS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|