C17H22N6O4 — CID 131889995
1-(2-ethoxyacetyl)-N-[4-(2H-tetrazol-5-yloxy)phenyl]piperidine-4-carboxamide (PubChem CID 131889995) has the molecular formula C17H22N6O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-(2-ethoxyacetyl)-N-[4-(2H-tetrazol-5-yloxy)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-ethoxyacetyl)-N-[4-(2H-tetrazol-5-yloxy)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 131889995 |
| Molecular Formula | C17H22N6O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1-(2-ethoxyacetyl)-N-[4-(2H-tetrazol-5-yloxy)phenyl]piperidine-4-carboxamide |
| SMILES | CCOCC(=O)N1CCC(C(=O)Nc2ccc(Oc3nn[nH]n3)cc2)CC1 |
| InChI | InChI=1S/C17H22N6O4/c1-2-26-11-15(24)23-9-7-12(8-10-23)16(25)18-13-3-5-14(6-4-13)27-17-19-21-22-20-17/h3-6,12H,2,7-11H2,1H3,(H,18,25)(H,19,20,21,22) |
| InChIKey | YTHHAWRJUTZQJX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |