C19H26N4O4 — CID 131922240
1-(2-ethoxyacetyl)-N-[2-(1-hydroxyethyl)-3H-benzimidazol-5-yl]piperidine-4-carboxamide (PubChem CID 131922240) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-(2-ethoxyacetyl)-N-[2-(1-hydroxyethyl)-3H-benzimidazol-5-yl]piperidine-4-carboxamide.
| Compound Name | 1-(2-ethoxyacetyl)-N-[2-(1-hydroxyethyl)-3H-benzimidazol-5-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 131922240 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 1-(2-ethoxyacetyl)-N-[2-(1-hydroxyethyl)-3H-benzimidazol-5-yl]piperidine-4-carboxamide |
| SMILES | CCOCC(=O)N1CCC(C(=O)Nc2ccc3nc(C(C)O)[nH]c3c2)CC1 |
| InChI | InChI=1S/C19H26N4O4/c1-3-27-11-17(25)23-8-6-13(7-9-23)19(26)20-14-4-5-15-16(10-14)22-18(21-15)12(2)24/h4-5,10,12-13,24H,3,6-9,11H2,1-2H3,(H,20,26)(H,21,22) |
| InChIKey | LGEQMTXARWFVTP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |