C20H20FN3O2 — CID 131890279
1-benzyl-3-[(4-fluorophenoxy)methyl]-5-(oxolan-3-yl)-1,2,4-triazole (PubChem CID 131890279) has the molecular formula C20H20FN3O2 and a molecular weight of 353.40 g/mol. Its IUPAC name is 1-benzyl-3-[(4-fluorophenoxy)methyl]-5-(oxolan-3-yl)-1,2,4-triazole.
| Compound Name | 1-benzyl-3-[(4-fluorophenoxy)methyl]-5-(oxolan-3-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 131890279 |
| Molecular Formula | C20H20FN3O2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-benzyl-3-[(4-fluorophenoxy)methyl]-5-(oxolan-3-yl)-1,2,4-triazole |
| SMILES | Fc1ccc(OCc2nc(C3CCOC3)n(Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H20FN3O2/c21-17-6-8-18(9-7-17)26-14-19-22-20(16-10-11-25-13-16)24(23-19)12-15-4-2-1-3-5-15/h1-9,16H,10-14H2 |
| InChIKey | KJPYUWVSQFXSNC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |