C17H19N5O3 — CID 72906414
3-[[2-benzyl-5-(oxolan-3-yl)-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione (PubChem CID 72906414) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-[[2-benzyl-5-(oxolan-3-yl)-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[[2-benzyl-5-(oxolan-3-yl)-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 72906414 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3-[[2-benzyl-5-(oxolan-3-yl)-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1Cc1nc(C2CCOC2)nn1Cc1ccccc1 |
| InChI | InChI=1S/C17H19N5O3/c23-15-8-18-17(24)21(15)10-14-19-16(13-6-7-25-11-13)20-22(14)9-12-4-2-1-3-5-12/h1-5,13H,6-11H2,(H,18,24) |
| InChIKey | LENFNZDTVNKTSR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|