C17H26F2O5S — CID 13189250
[4-(1-ethoxyethoxy)-3,3-difluoro-4-methylpentyl] 4-methylbenzenesulfonate (PubChem CID 13189250) has the molecular formula C17H26F2O5S and a molecular weight of 380.45 g/mol. Its IUPAC name is [4-(1-ethoxyethoxy)-3,3-difluoro-4-methylpentyl] 4-methylbenzenesulfonate.
| Compound Name | [4-(1-ethoxyethoxy)-3,3-difluoro-4-methylpentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 13189250 |
| Molecular Formula | C17H26F2O5S |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [4-(1-ethoxyethoxy)-3,3-difluoro-4-methylpentyl] 4-methylbenzenesulfonate |
| SMILES | CCOC(C)OC(C)(C)C(F)(F)CCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H26F2O5S/c1-6-22-14(3)24-16(4,5)17(18,19)11-12-23-25(20,21)15-9-7-13(2)8-10-15/h7-10,14H,6,11-12H2,1-5H3 |
| InChIKey | ZFYKPWMCAPEBOO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|