About 2-[5-(4-methoxy-2-pyridinyl)-3-(2-methylpropyl)-1,2,4-triazol-1-yl]ethanol
2-[5-(4-methoxy-2-pyridinyl)-3-(2-methylpropyl)-1,2,4-triazol-1-yl]ethanol (PubChem CID 131892710) has the molecular formula C14H20N4O2
and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-[5-(4-methoxy-2-pyridinyl)-3-(2-methylpropyl)-1,2,4-triazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[5-(4-methoxy-2-pyridinyl)-3-(2-methylpropyl)-1,2,4-triazol-1-yl]ethanol |
| PubChem CID | 131892710 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-[5-(4-methoxy-2-pyridinyl)-3-(2-methylpropyl)-1,2,4-triazol-1-yl]ethanol |
| SMILES | COc1ccnc(-c2nc(CC(C)C)nn2CCO)c1 |
| InChI | InChI=1S/C14H20N4O2/c1-10(2)8-13-16-14(18(17-13)6-7-19)12-9-11(20-3)4-5-15-12/h4-5,9-10,19H,6-8H2,1-3H3 |
| InChIKey | MAVKGSCJIAHIMP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-(4-methoxy-2-pyridinyl)-3-(2-methylpropyl)-1,2,4-triazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-methoxy-2-pyridinyl)-3-(2-methylpropyl)-1,2,4-triazol-1-yl]ethanol?
The IUPAC name of 2-[5-(4-methoxy-2-pyridinyl)-3-(2-methylpropyl)-1,2,4-triazol-1-yl]ethanol (CID 131892710) is 2-[5-(4-methoxy-2-pyridinyl)-3-(2-methylpropyl)-1,2,4-triazol-1-yl]ethanol.
What is the SMILES notation for 2-[5-(4-methoxy-2-pyridinyl)-3-(2-methylpropyl)-1,2,4-triazol-1-yl]ethanol?
The canonical SMILES for 2-[5-(4-methoxy-2-pyridinyl)-3-(2-methylpropyl)-1,2,4-triazol-1-yl]ethanol is COc1ccnc(-c2nc(CC(C)C)nn2CCO)c1.
What is the InChIKey of 2-[5-(4-methoxy-2-pyridinyl)-3-(2-methylpropyl)-1,2,4-triazol-1-yl]ethanol?
The InChIKey is MAVKGSCJIAHIMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O2/c1-10(2)8-13-16-14(18(17-13)6-7-19)12-9-11(20-3)4-5-15-12/h4-5,9-10,19H,6-8H2,1-3H3.
What are the key properties of 2-[5-(4-methoxy-2-pyridinyl)-3-(2-methylpropyl)-1,2,4-triazol-1-yl]ethanol?
2-[5-(4-methoxy-2-pyridinyl)-3-(2-methylpropyl)-1,2,4-triazol-1-yl]ethanol has a molecular weight of 276.34 g/mol, XLogP of 1.54, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-methoxy-2-pyridinyl)-3-(2-methylpropyl)-1,2,4-triazol-1-yl]ethanol is sourced from PubChem (CID 131892710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).