C16H22N4OS — CID 131893031
N-[[1-[(5-methyl-1H-imidazol-2-yl)methyl]piperidin-3-yl]methyl]thiophene-3-carboxamide (PubChem CID 131893031) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is N-[[1-[(5-methyl-1H-imidazol-2-yl)methyl]piperidin-3-yl]methyl]thiophene-3-carboxamide.
| Compound Name | N-[[1-[(5-methyl-1H-imidazol-2-yl)methyl]piperidin-3-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 131893031 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-[[1-[(5-methyl-1H-imidazol-2-yl)methyl]piperidin-3-yl]methyl]thiophene-3-carboxamide |
| SMILES | Cc1cnc(CN2CCCC(CNC(=O)c3ccsc3)C2)[nH]1 |
| InChI | InChI=1S/C16H22N4OS/c1-12-7-17-15(19-12)10-20-5-2-3-13(9-20)8-18-16(21)14-4-6-22-11-14/h4,6-7,11,13H,2-3,5,8-10H2,1H3,(H,17,19)(H,18,21) |
| InChIKey | JNDYMZIRUZZVEP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |