C19H17FN4O3S — CID 131894017
8-fluoro-2-[2-methyl-5-(1H-pyrazol-5-yl)furan-3-yl]sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 131894017) has the molecular formula C19H17FN4O3S and a molecular weight of 400.44 g/mol. Its IUPAC name is 8-fluoro-2-[2-methyl-5-(1H-pyrazol-5-yl)furan-3-yl]sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 8-fluoro-2-[2-methyl-5-(1H-pyrazol-5-yl)furan-3-yl]sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 131894017 |
| Molecular Formula | C19H17FN4O3S |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 8-fluoro-2-[2-methyl-5-(1H-pyrazol-5-yl)furan-3-yl]sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | Cc1oc(-c2ccn[nH]2)cc1S(=O)(=O)N1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C19H17FN4O3S/c1-11-19(9-18(27-11)17-4-6-21-23-17)28(25,26)24-7-5-16-14(10-24)13-8-12(20)2-3-15(13)22-16/h2-4,6,8-9,22H,5,7,10H2,1H3,(H,21,23) |
| InChIKey | AZIYNTBPAUKGRC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|