C16H21N3OS — CID 13189630
2-(4-butylphenyl)-3-sulfanylidene-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-1-one (PubChem CID 13189630) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 2-(4-butylphenyl)-3-sulfanylidene-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-1-one.
| Compound Name | 2-(4-butylphenyl)-3-sulfanylidene-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-1-one |
|---|---|
| PubChem CID | 13189630 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-(4-butylphenyl)-3-sulfanylidene-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-1-one |
| SMILES | CCCCc1ccc(-n2c(=O)n3n(c2=S)CCCC3)cc1 |
| InChI | InChI=1S/C16H21N3OS/c1-2-3-6-13-7-9-14(10-8-13)19-15(20)17-11-4-5-12-18(17)16(19)21/h7-10H,2-6,11-12H2,1H3 |
| InChIKey | BKXBDTKKKMJPCZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 31.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|