C22H30N2O2 — CID 131897295
1-[[3-(5-methylfuran-2-yl)phenyl]methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-ol (PubChem CID 131897295) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 1-[[3-(5-methylfuran-2-yl)phenyl]methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-ol.
| Compound Name | 1-[[3-(5-methylfuran-2-yl)phenyl]methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 131897295 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1-[[3-(5-methylfuran-2-yl)phenyl]methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-ol |
| SMILES | Cc1ccc(-c2cccc(CN3CCC(O)(CN4CCCC4)CC3)c2)o1 |
| InChI | InChI=1S/C22H30N2O2/c1-18-7-8-21(26-18)20-6-4-5-19(15-20)16-23-13-9-22(25,10-14-23)17-24-11-2-3-12-24/h4-8,15,25H,2-3,9-14,16-17H2,1H3 |
| InChIKey | WGZGJBOYZHSBPH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |