C21H33N3O3 — CID 132771184
3-(morpholin-4-ylmethyl)-1-[[3-(morpholin-4-ylmethyl)phenyl]methyl]pyrrolidin-3-ol (PubChem CID 132771184) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is 3-(morpholin-4-ylmethyl)-1-[[3-(morpholin-4-ylmethyl)phenyl]methyl]pyrrolidin-3-ol.
| Compound Name | 3-(morpholin-4-ylmethyl)-1-[[3-(morpholin-4-ylmethyl)phenyl]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 132771184 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 3-(morpholin-4-ylmethyl)-1-[[3-(morpholin-4-ylmethyl)phenyl]methyl]pyrrolidin-3-ol |
| SMILES | OC1(CN2CCOCC2)CCN(Cc2cccc(CN3CCOCC3)c2)C1 |
| InChI | InChI=1S/C21H33N3O3/c25-21(17-23-8-12-27-13-9-23)4-5-24(18-21)16-20-3-1-2-19(14-20)15-22-6-10-26-11-7-22/h1-3,14,25H,4-13,15-18H2 |
| InChIKey | WJERZPSIHZHVEX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 48.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |