C17H21NO3 — CID 70788847
4-[[3-(5-methylfuran-2-yl)phenyl]methyl]-1,4-oxazepan-6-ol (PubChem CID 70788847) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[[3-(5-methylfuran-2-yl)phenyl]methyl]-1,4-oxazepan-6-ol.
| Compound Name | 4-[[3-(5-methylfuran-2-yl)phenyl]methyl]-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 70788847 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-[[3-(5-methylfuran-2-yl)phenyl]methyl]-1,4-oxazepan-6-ol |
| SMILES | Cc1ccc(-c2cccc(CN3CCOCC(O)C3)c2)o1 |
| InChI | InChI=1S/C17H21NO3/c1-13-5-6-17(21-13)15-4-2-3-14(9-15)10-18-7-8-20-12-16(19)11-18/h2-6,9,16,19H,7-8,10-12H2,1H3 |
| InChIKey | MYLSPJCRBZYGAW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |