C25H27NO4 — CID 131898114
N-[4-(oxan-2-ylmethoxy)phenyl]-2-(5-oxo-2-phenylcyclopenten-1-yl)acetamide (PubChem CID 131898114) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is N-[4-(oxan-2-ylmethoxy)phenyl]-2-(5-oxo-2-phenylcyclopenten-1-yl)acetamide.
| Compound Name | N-[4-(oxan-2-ylmethoxy)phenyl]-2-(5-oxo-2-phenylcyclopenten-1-yl)acetamide |
|---|---|
| PubChem CID | 131898114 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-[4-(oxan-2-ylmethoxy)phenyl]-2-(5-oxo-2-phenylcyclopenten-1-yl)acetamide |
| SMILES | O=C(CC1=C(c2ccccc2)CCC1=O)Nc1ccc(OCC2CCCCO2)cc1 |
| InChI | InChI=1S/C25H27NO4/c27-24-14-13-22(18-6-2-1-3-7-18)23(24)16-25(28)26-19-9-11-20(12-10-19)30-17-21-8-4-5-15-29-21/h1-3,6-7,9-12,21H,4-5,8,13-17H2,(H,26,28) |
| InChIKey | YEZJEDDLVZGGFL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |