C12H18FN3O3 — CID 131900324
4-(5-fluoro-4-methoxypyrimidin-2-yl)-2-(2-methoxyethyl)morpholine (PubChem CID 131900324) has the molecular formula C12H18FN3O3 and a molecular weight of 271.29 g/mol. Its IUPAC name is 4-(5-fluoro-4-methoxypyrimidin-2-yl)-2-(2-methoxyethyl)morpholine.
| Compound Name | 4-(5-fluoro-4-methoxypyrimidin-2-yl)-2-(2-methoxyethyl)morpholine |
|---|---|
| PubChem CID | 131900324 |
| Molecular Formula | C12H18FN3O3 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 4-(5-fluoro-4-methoxypyrimidin-2-yl)-2-(2-methoxyethyl)morpholine |
| SMILES | COCCC1CN(c2ncc(F)c(OC)n2)CCO1 |
| InChI | InChI=1S/C12H18FN3O3/c1-17-5-3-9-8-16(4-6-19-9)12-14-7-10(13)11(15-12)18-2/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | RHPBBYYCKRRVMD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |