C21H23ClFN5O2 — CID 170231345
(2R)-4-[4-(4-chloro-2-fluorophenyl)-7-methylpteridin-2-yl]-2-(3-methoxypropyl)morpholine (PubChem CID 170231345) has the molecular formula C21H23ClFN5O2 and a molecular weight of 431.90 g/mol. Its IUPAC name is (2R)-4-[4-(4-chloro-2-fluorophenyl)-7-methylpteridin-2-yl]-2-(3-methoxypropyl)morpholine.
| Compound Name | (2R)-4-[4-(4-chloro-2-fluorophenyl)-7-methylpteridin-2-yl]-2-(3-methoxypropyl)morpholine |
|---|---|
| PubChem CID | 170231345 |
| Molecular Formula | C21H23ClFN5O2 |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (2R)-4-[4-(4-chloro-2-fluorophenyl)-7-methylpteridin-2-yl]-2-(3-methoxypropyl)morpholine |
| SMILES | COCCC[C@@H]1CN(c2nc(-c3ccc(Cl)cc3F)c3ncc(C)nc3n2)CCO1 |
| InChI | InChI=1S/C21H23ClFN5O2/c1-13-11-24-19-18(16-6-5-14(22)10-17(16)23)26-21(27-20(19)25-13)28-7-9-30-15(12-28)4-3-8-29-2/h5-6,10-11,15H,3-4,7-9,12H2,1-2H3/t15-/m1/s1 |
| InChIKey | WBZYEUHVJWRAKJ-OAHLLOKOSA-N |
| XLogP | 3.82 |
| TPSA | 73.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|