C11H19N7S — CID 131901116
1-(2-methylimidazol-1-yl)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]propan-2-amine (PubChem CID 131901116) has the molecular formula C11H19N7S and a molecular weight of 281.39 g/mol. Its IUPAC name is 1-(2-methylimidazol-1-yl)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]propan-2-amine.
| Compound Name | 1-(2-methylimidazol-1-yl)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]propan-2-amine |
|---|---|
| PubChem CID | 131901116 |
| Molecular Formula | C11H19N7S |
| Molecular Weight | 281.39 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-(2-methylimidazol-1-yl)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]propan-2-amine |
| SMILES | Cc1nccn1CC(C)NCCSc1nnnn1C |
| InChI | InChI=1S/C11H19N7S/c1-9(8-18-6-4-13-10(18)2)12-5-7-19-11-14-15-16-17(11)3/h4,6,9,12H,5,7-8H2,1-3H3 |
| InChIKey | HXYQHNGJOLGTSO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|