C20H21N3O3 — CID 131902671
2-(aminomethyl)-N-[2-(3-phenylpropoxy)phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 131902671) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[2-(3-phenylpropoxy)phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-[2-(3-phenylpropoxy)phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 131902671 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-(aminomethyl)-N-[2-(3-phenylpropoxy)phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | NCc1nc(C(=O)Nc2ccccc2OCCCc2ccccc2)co1 |
| InChI | InChI=1S/C20H21N3O3/c21-13-19-22-17(14-26-19)20(24)23-16-10-4-5-11-18(16)25-12-6-9-15-7-2-1-3-8-15/h1-5,7-8,10-11,14H,6,9,12-13,21H2,(H,23,24) |
| InChIKey | PZDFBDOOIYOGII-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|