C24H24N2O4 — CID 55675187
ethyl 2-methyl-6-[[2-(2-phenylethoxy)phenyl]carbamoyl]pyridine-3-carboxylate (PubChem CID 55675187) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is ethyl 2-methyl-6-[[2-(2-phenylethoxy)phenyl]carbamoyl]pyridine-3-carboxylate.
| Compound Name | ethyl 2-methyl-6-[[2-(2-phenylethoxy)phenyl]carbamoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55675187 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | ethyl 2-methyl-6-[[2-(2-phenylethoxy)phenyl]carbamoyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(C(=O)Nc2ccccc2OCCc2ccccc2)nc1C |
| InChI | InChI=1S/C24H24N2O4/c1-3-29-24(28)19-13-14-21(25-17(19)2)23(27)26-20-11-7-8-12-22(20)30-16-15-18-9-5-4-6-10-18/h4-14H,3,15-16H2,1-2H3,(H,26,27) |
| InChIKey | ZASLZHZMAQHUPH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |