C17H24N4O — CID 131902997
2-amino-N-[1-(cyclohexen-1-yl)ethyl]-5,6,7,8-tetrahydroquinazoline-4-carboxamide (PubChem CID 131902997) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 2-amino-N-[1-(cyclohexen-1-yl)ethyl]-5,6,7,8-tetrahydroquinazoline-4-carboxamide.
| Compound Name | 2-amino-N-[1-(cyclohexen-1-yl)ethyl]-5,6,7,8-tetrahydroquinazoline-4-carboxamide |
|---|---|
| PubChem CID | 131902997 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 2-amino-N-[1-(cyclohexen-1-yl)ethyl]-5,6,7,8-tetrahydroquinazoline-4-carboxamide |
| SMILES | CC(NC(=O)c1nc(N)nc2c1CCCC2)C1=CCCCC1 |
| InChI | InChI=1S/C17H24N4O/c1-11(12-7-3-2-4-8-12)19-16(22)15-13-9-5-6-10-14(13)20-17(18)21-15/h7,11H,2-6,8-10H2,1H3,(H,19,22)(H2,18,20,21) |
| InChIKey | DFSKRGBBJXRJFF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|