C14H19N3O3 — CID 164634372
N-[(1S)-1-(cyclohexen-1-yl)ethyl]-1-methyl-2,4-dioxopyrimidine-5-carboxamide (PubChem CID 164634372) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-[(1S)-1-(cyclohexen-1-yl)ethyl]-1-methyl-2,4-dioxopyrimidine-5-carboxamide.
| Compound Name | N-[(1S)-1-(cyclohexen-1-yl)ethyl]-1-methyl-2,4-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 164634372 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N-[(1S)-1-(cyclohexen-1-yl)ethyl]-1-methyl-2,4-dioxopyrimidine-5-carboxamide |
| SMILES | C[C@H](NC(=O)c1cn(C)c(=O)[nH]c1=O)C1=CCCCC1 |
| InChI | InChI=1S/C14H19N3O3/c1-9(10-6-4-3-5-7-10)15-12(18)11-8-17(2)14(20)16-13(11)19/h6,8-9H,3-5,7H2,1-2H3,(H,15,18)(H,16,19,20)/t9-/m0/s1 |
| InChIKey | UTJHTFHYQJRXMV-VIFPVBQESA-N |
| XLogP | 0.69 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|