C9H13N3O5S — CID 154775362
1-methyl-2,4-dioxo-N-propan-2-ylsulfonylpyrimidine-5-carboxamide (PubChem CID 154775362) has the molecular formula C9H13N3O5S and a molecular weight of 275.29 g/mol. Its IUPAC name is 1-methyl-2,4-dioxo-N-propan-2-ylsulfonylpyrimidine-5-carboxamide.
| Compound Name | 1-methyl-2,4-dioxo-N-propan-2-ylsulfonylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 154775362 |
| Molecular Formula | C9H13N3O5S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 1-methyl-2,4-dioxo-N-propan-2-ylsulfonylpyrimidine-5-carboxamide |
| SMILES | CC(C)S(=O)(=O)NC(=O)c1cn(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H13N3O5S/c1-5(2)18(16,17)11-8(14)6-4-12(3)9(15)10-7(6)13/h4-5H,1-3H3,(H,11,14)(H,10,13,15) |
| InChIKey | AITGOLASFKMQDV-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |