C19H22N2O2 — CID 99927276
N-[(1R)-1-(cyclohexen-1-yl)ethyl]-1-methyl-2-oxoquinoline-4-carboxamide (PubChem CID 99927276) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[(1R)-1-(cyclohexen-1-yl)ethyl]-1-methyl-2-oxoquinoline-4-carboxamide.
| Compound Name | N-[(1R)-1-(cyclohexen-1-yl)ethyl]-1-methyl-2-oxoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 99927276 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-[(1R)-1-(cyclohexen-1-yl)ethyl]-1-methyl-2-oxoquinoline-4-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cc(=O)n(C)c2ccccc12)C1=CCCCC1 |
| InChI | InChI=1S/C19H22N2O2/c1-13(14-8-4-3-5-9-14)20-19(23)16-12-18(22)21(2)17-11-7-6-10-15(16)17/h6-8,10-13H,3-5,9H2,1-2H3,(H,20,23)/t13-/m1/s1 |
| InChIKey | DVVDHTHVLKFERS-CYBMUJFWSA-N |
| XLogP | 3.16 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|