C13H17NOS — CID 131890483
N-[1-(cyclohexen-1-yl)ethyl]thiophene-3-carboxamide (PubChem CID 131890483) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is N-[1-(cyclohexen-1-yl)ethyl]thiophene-3-carboxamide.
| Compound Name | N-[1-(cyclohexen-1-yl)ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 131890483 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-[1-(cyclohexen-1-yl)ethyl]thiophene-3-carboxamide |
| SMILES | CC(NC(=O)c1ccsc1)C1=CCCCC1 |
| InChI | InChI=1S/C13H17NOS/c1-10(11-5-3-2-4-6-11)14-13(15)12-7-8-16-9-12/h5,7-10H,2-4,6H2,1H3,(H,14,15) |
| InChIKey | DRIOXFLSRVRFNN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|