C19H29N5O — CID 131904981
(E)-3-[2-(dimethylamino)pyrimidin-5-yl]-1-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 131904981) has the molecular formula C19H29N5O and a molecular weight of 343.48 g/mol. Its IUPAC name is (E)-3-[2-(dimethylamino)pyrimidin-5-yl]-1-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[2-(dimethylamino)pyrimidin-5-yl]-1-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 131904981 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | (E)-3-[2-(dimethylamino)pyrimidin-5-yl]-1-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | CN(C)c1ncc(/C=C/C(=O)N2CCCCC2CN2CCCC2)cn1 |
| InChI | InChI=1S/C19H29N5O/c1-22(2)19-20-13-16(14-21-19)8-9-18(25)24-12-4-3-7-17(24)15-23-10-5-6-11-23/h8-9,13-14,17H,3-7,10-12,15H2,1-2H3/b9-8+ |
| InChIKey | RUGXWSIYPYGKFI-CMDGGOBGSA-N |
| XLogP | 2.03 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|