C19H23F3N2O4S — CID 21049047
[4-[(E)-3-oxo-3-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-1-enyl]phenyl] trifluoromethanesulfonate (PubChem CID 21049047) has the molecular formula C19H23F3N2O4S and a molecular weight of 432.46 g/mol. Its IUPAC name is [4-[(E)-3-oxo-3-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-1-enyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(E)-3-oxo-3-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-1-enyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 21049047 |
| Molecular Formula | C19H23F3N2O4S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | [4-[(E)-3-oxo-3-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-1-enyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=C(/C=C/c1ccc(OS(=O)(=O)C(F)(F)F)cc1)N1CCCC1CN1CCCC1 |
| InChI | InChI=1S/C19H23F3N2O4S/c20-19(21,22)29(26,27)28-17-8-5-15(6-9-17)7-10-18(25)24-13-3-4-16(24)14-23-11-1-2-12-23/h5-10,16H,1-4,11-14H2/b10-7+ |
| InChIKey | QKQPAGCIOIHDPV-JXMROGBWSA-N |
| XLogP | 3.02 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|