C16H22N4O — CID 131927601
(E)-3-[2-(dimethylamino)pyrimidin-5-yl]-1-(2-propyl-2,5-dihydropyrrol-1-yl)prop-2-en-1-one (PubChem CID 131927601) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is (E)-3-[2-(dimethylamino)pyrimidin-5-yl]-1-(2-propyl-2,5-dihydropyrrol-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[2-(dimethylamino)pyrimidin-5-yl]-1-(2-propyl-2,5-dihydropyrrol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 131927601 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (E)-3-[2-(dimethylamino)pyrimidin-5-yl]-1-(2-propyl-2,5-dihydropyrrol-1-yl)prop-2-en-1-one |
| SMILES | CCCC1C=CCN1C(=O)/C=C/c1cnc(N(C)C)nc1 |
| InChI | InChI=1S/C16H22N4O/c1-4-6-14-7-5-10-20(14)15(21)9-8-13-11-17-16(18-12-13)19(2)3/h5,7-9,11-12,14H,4,6,10H2,1-3H3/b9-8+ |
| InChIKey | LDFSJABFEHARRK-CMDGGOBGSA-N |
| XLogP | 2.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|