C12H16N4O3 — CID 171139446
3-[2-(dimethylamino)pyrimidin-5-yl]-1-(4-hydroxy-1,2-oxazolidin-2-yl)prop-2-en-1-one (PubChem CID 171139446) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is 3-[2-(dimethylamino)pyrimidin-5-yl]-1-(4-hydroxy-1,2-oxazolidin-2-yl)prop-2-en-1-one.
| Compound Name | 3-[2-(dimethylamino)pyrimidin-5-yl]-1-(4-hydroxy-1,2-oxazolidin-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 171139446 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 3-[2-(dimethylamino)pyrimidin-5-yl]-1-(4-hydroxy-1,2-oxazolidin-2-yl)prop-2-en-1-one |
| SMILES | CN(C)c1ncc(C=CC(=O)N2CC(O)CO2)cn1 |
| InChI | InChI=1S/C12H16N4O3/c1-15(2)12-13-5-9(6-14-12)3-4-11(18)16-7-10(17)8-19-16/h3-6,10,17H,7-8H2,1-2H3 |
| InChIKey | OYQQCEYXRRVJDC-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|