C16H26N4O2 — CID 131907453
4-N-[(3R,4S)-3-methoxyoxan-4-yl]-2-N,2-N-dimethyl-5,6,7,8-tetrahydroquinazoline-2,4-diamine (PubChem CID 131907453) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-N-[(3R,4S)-3-methoxyoxan-4-yl]-2-N,2-N-dimethyl-5,6,7,8-tetrahydroquinazoline-2,4-diamine.
| Compound Name | 4-N-[(3R,4S)-3-methoxyoxan-4-yl]-2-N,2-N-dimethyl-5,6,7,8-tetrahydroquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 131907453 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 4-N-[(3R,4S)-3-methoxyoxan-4-yl]-2-N,2-N-dimethyl-5,6,7,8-tetrahydroquinazoline-2,4-diamine |
| SMILES | CO[C@H]1COCC[C@@H]1Nc1nc(N(C)C)nc2c1CCCC2 |
| InChI | InChI=1S/C16H26N4O2/c1-20(2)16-18-12-7-5-4-6-11(12)15(19-16)17-13-8-9-22-10-14(13)21-3/h13-14H,4-10H2,1-3H3,(H,17,18,19)/t13-,14-/m0/s1 |
| InChIKey | YBKBIJGBVCAAIS-KBPBESRZSA-N |
| XLogP | 1.64 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |