C17H26N6 — CID 131908435
4-amino-2-[2-(1-cyclopentylpiperidin-2-yl)ethylamino]pyrimidine-5-carbonitrile (PubChem CID 131908435) has the molecular formula C17H26N6 and a molecular weight of 314.44 g/mol. Its IUPAC name is 4-amino-2-[2-(1-cyclopentylpiperidin-2-yl)ethylamino]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-[2-(1-cyclopentylpiperidin-2-yl)ethylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 131908435 |
| Molecular Formula | C17H26N6 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 4-amino-2-[2-(1-cyclopentylpiperidin-2-yl)ethylamino]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(NCCC2CCCCN2C2CCCC2)nc1N |
| InChI | InChI=1S/C17H26N6/c18-11-13-12-21-17(22-16(13)19)20-9-8-15-7-3-4-10-23(15)14-5-1-2-6-14/h12,14-15H,1-10H2,(H3,19,20,21,22) |
| InChIKey | OMXWTIFMUPBUDG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |