About 4-amino-2-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylamino]pyrimidine-5-carbonitrile
4-amino-2-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylamino]pyrimidine-5-carbonitrile (PubChem CID 131921036) has the molecular formula C11H13N7O
and a molecular weight of 259.27 g/mol. Its IUPAC name is 4-amino-2-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylamino]pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-2-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylamino]pyrimidine-5-carbonitrile |
| PubChem CID | 131921036 |
| Molecular Formula | C11H13N7O |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-amino-2-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylamino]pyrimidine-5-carbonitrile |
| SMILES | CCc1noc(CCNc2ncc(C#N)c(N)n2)n1 |
| InChI | InChI=1S/C11H13N7O/c1-2-8-16-9(19-18-8)3-4-14-11-15-6-7(5-12)10(13)17-11/h6H,2-4H2,1H3,(H3,13,14,15,17) |
| InChIKey | OAPOMCIXDPGNBP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-amino-2-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylamino]pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylamino]pyrimidine-5-carbonitrile?
The IUPAC name of 4-amino-2-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylamino]pyrimidine-5-carbonitrile (CID 131921036) is 4-amino-2-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylamino]pyrimidine-5-carbonitrile.
What is the SMILES notation for 4-amino-2-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylamino]pyrimidine-5-carbonitrile?
The canonical SMILES for 4-amino-2-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylamino]pyrimidine-5-carbonitrile is CCc1noc(CCNc2ncc(C#N)c(N)n2)n1.
What is the InChIKey of 4-amino-2-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylamino]pyrimidine-5-carbonitrile?
The InChIKey is OAPOMCIXDPGNBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N7O/c1-2-8-16-9(19-18-8)3-4-14-11-15-6-7(5-12)10(13)17-11/h6H,2-4H2,1H3,(H3,13,14,15,17).
What are the key properties of 4-amino-2-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylamino]pyrimidine-5-carbonitrile?
4-amino-2-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylamino]pyrimidine-5-carbonitrile has a molecular weight of 259.27 g/mol, XLogP of 0.53, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylamino]pyrimidine-5-carbonitrile is sourced from PubChem (CID 131921036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).