C16H18N4O — CID 131909357
N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]cyclohex-3-ene-1-carboxamide (PubChem CID 131909357) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 131909357 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]cyclohex-3-ene-1-carboxamide |
| SMILES | Cc1nc(-c2cccc(NC(=O)C3CC=CCC3)c2)n[nH]1 |
| InChI | InChI=1S/C16H18N4O/c1-11-17-15(20-19-11)13-8-5-9-14(10-13)18-16(21)12-6-3-2-4-7-12/h2-3,5,8-10,12H,4,6-7H2,1H3,(H,18,21)(H,17,19,20) |
| InChIKey | DPAOTSWLFGJENA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|