C12H25N3O3S — CID 131909816
N-[2-(methylsulfamoyl)ethyl]-1-propan-2-ylpiperidine-4-carboxamide (PubChem CID 131909816) has the molecular formula C12H25N3O3S and a molecular weight of 291.42 g/mol. Its IUPAC name is N-[2-(methylsulfamoyl)ethyl]-1-propan-2-ylpiperidine-4-carboxamide.
| Compound Name | N-[2-(methylsulfamoyl)ethyl]-1-propan-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 131909816 |
| Molecular Formula | C12H25N3O3S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[2-(methylsulfamoyl)ethyl]-1-propan-2-ylpiperidine-4-carboxamide |
| SMILES | CNS(=O)(=O)CCNC(=O)C1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C12H25N3O3S/c1-10(2)15-7-4-11(5-8-15)12(16)14-6-9-19(17,18)13-3/h10-11,13H,4-9H2,1-3H3,(H,14,16) |
| InChIKey | RMIPDYGLCXJOBF-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |