C20H27ClN2O3 — CID 131911841
9-[(2-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 131911841) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is 9-[(2-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-[(2-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 131911841 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 9-[(2-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | C=CCOc1cc(Cl)c(CN2CCC3(CCC(=O)NC3)CC2)cc1OC |
| InChI | InChI=1S/C20H27ClN2O3/c1-3-10-26-18-12-16(21)15(11-17(18)25-2)13-23-8-6-20(7-9-23)5-4-19(24)22-14-20/h3,11-12H,1,4-10,13-14H2,2H3,(H,22,24) |
| InChIKey | ZDNYDSVLYVOGMI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|