C19H29ClN2O3 — CID 131943086
1-[(2-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol (PubChem CID 131943086) has the molecular formula C19H29ClN2O3 and a molecular weight of 368.91 g/mol. Its IUPAC name is 1-[(2-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol.
| Compound Name | 1-[(2-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 131943086 |
| Molecular Formula | C19H29ClN2O3 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 1-[(2-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol |
| SMILES | C=CCOc1cc(Cl)c(CN2CCCC(O)(CN(C)C)C2)cc1OC |
| InChI | InChI=1S/C19H29ClN2O3/c1-5-9-25-18-11-16(20)15(10-17(18)24-4)12-22-8-6-7-19(23,14-22)13-21(2)3/h5,10-11,23H,1,6-9,12-14H2,2-4H3 |
| InChIKey | RMPCZENVXWGRPH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|