C14H22ClN3O4S — CID 77089726
4-[(2-chloro-5-ethoxy-4-methoxyphenyl)methyl]piperazine-1-sulfonamide (PubChem CID 77089726) has the molecular formula C14H22ClN3O4S and a molecular weight of 363.87 g/mol. Its IUPAC name is 4-[(2-chloro-5-ethoxy-4-methoxyphenyl)methyl]piperazine-1-sulfonamide.
| Compound Name | 4-[(2-chloro-5-ethoxy-4-methoxyphenyl)methyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 77089726 |
| Molecular Formula | C14H22ClN3O4S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 4-[(2-chloro-5-ethoxy-4-methoxyphenyl)methyl]piperazine-1-sulfonamide |
| SMILES | CCOc1cc(CN2CCN(S(N)(=O)=O)CC2)c(Cl)cc1OC |
| InChI | InChI=1S/C14H22ClN3O4S/c1-3-22-14-8-11(12(15)9-13(14)21-2)10-17-4-6-18(7-5-17)23(16,19)20/h8-9H,3-7,10H2,1-2H3,(H2,16,19,20) |
| InChIKey | FMVPBWAVNBUJHB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |