C18H22N2O2S — CID 131913983
2-(5-acetylthiophen-3-yl)-N-butyl-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 131913983) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is 2-(5-acetylthiophen-3-yl)-N-butyl-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-(5-acetylthiophen-3-yl)-N-butyl-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 131913983 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-(5-acetylthiophen-3-yl)-N-butyl-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | CCCCN(Cc1cccnc1)C(=O)Cc1csc(C(C)=O)c1 |
| InChI | InChI=1S/C18H22N2O2S/c1-3-4-8-20(12-15-6-5-7-19-11-15)18(22)10-16-9-17(14(2)21)23-13-16/h5-7,9,11,13H,3-4,8,10,12H2,1-2H3 |
| InChIKey | RLYLIBBFPNTETF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |