C23H37N3O2 — CID 131915440
2-(4-methoxyanilino)-2-methyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide (PubChem CID 131915440) has the molecular formula C23H37N3O2 and a molecular weight of 387.57 g/mol. Its IUPAC name is 2-(4-methoxyanilino)-2-methyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide.
| Compound Name | 2-(4-methoxyanilino)-2-methyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 131915440 |
| Molecular Formula | C23H37N3O2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | 2-(4-methoxyanilino)-2-methyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide |
| SMILES | COc1ccc(NC(C)(C)C(=O)NCC2(N3CCCCC3)CCCCC2)cc1 |
| InChI | InChI=1S/C23H37N3O2/c1-22(2,25-19-10-12-20(28-3)13-11-19)21(27)24-18-23(14-6-4-7-15-23)26-16-8-5-9-17-26/h10-13,25H,4-9,14-18H2,1-3H3,(H,24,27) |
| InChIKey | VFZKDLCJXXDBGU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|