C19H18N2O2S — CID 131916205
3-[5-[[furan-2-ylmethyl(pyridin-2-ylmethyl)amino]methyl]thiophen-3-yl]prop-2-yn-1-ol (PubChem CID 131916205) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is 3-[5-[[furan-2-ylmethyl(pyridin-2-ylmethyl)amino]methyl]thiophen-3-yl]prop-2-yn-1-ol.
| Compound Name | 3-[5-[[furan-2-ylmethyl(pyridin-2-ylmethyl)amino]methyl]thiophen-3-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 131916205 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 3-[5-[[furan-2-ylmethyl(pyridin-2-ylmethyl)amino]methyl]thiophen-3-yl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1csc(CN(Cc2ccccn2)Cc2ccco2)c1 |
| InChI | InChI=1S/C19H18N2O2S/c22-9-3-5-16-11-19(24-15-16)14-21(13-18-7-4-10-23-18)12-17-6-1-2-8-20-17/h1-2,4,6-8,10-11,15,22H,9,12-14H2 |
| InChIKey | HCVRALQOFWJIES-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|