C11H9NO2S2 — CID 106924451
3-[5-(1,3-oxazol-2-ylsulfanylmethyl)thiophen-3-yl]prop-2-yn-1-ol (PubChem CID 106924451) has the molecular formula C11H9NO2S2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-[5-(1,3-oxazol-2-ylsulfanylmethyl)thiophen-3-yl]prop-2-yn-1-ol.
| Compound Name | 3-[5-(1,3-oxazol-2-ylsulfanylmethyl)thiophen-3-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 106924451 |
| Molecular Formula | C11H9NO2S2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 3-[5-(1,3-oxazol-2-ylsulfanylmethyl)thiophen-3-yl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1csc(CSc2ncco2)c1 |
| InChI | InChI=1S/C11H9NO2S2/c13-4-1-2-9-6-10(15-7-9)8-16-11-12-3-5-14-11/h3,5-7,13H,4,8H2 |
| InChIKey | JIASIUAJEOBCNI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|