C22H24N2O5 — CID 131916676
4-methyl-N-[4-(oxan-2-ylmethoxy)phenyl]-3-oxo-1,4-benzoxazine-6-carboxamide (PubChem CID 131916676) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 4-methyl-N-[4-(oxan-2-ylmethoxy)phenyl]-3-oxo-1,4-benzoxazine-6-carboxamide.
| Compound Name | 4-methyl-N-[4-(oxan-2-ylmethoxy)phenyl]-3-oxo-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 131916676 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 4-methyl-N-[4-(oxan-2-ylmethoxy)phenyl]-3-oxo-1,4-benzoxazine-6-carboxamide |
| SMILES | CN1C(=O)COc2ccc(C(=O)Nc3ccc(OCC4CCCCO4)cc3)cc21 |
| InChI | InChI=1S/C22H24N2O5/c1-24-19-12-15(5-10-20(19)29-14-21(24)25)22(26)23-16-6-8-17(9-7-16)28-13-18-4-2-3-11-27-18/h5-10,12,18H,2-4,11,13-14H2,1H3,(H,23,26) |
| InChIKey | KKADOLHJDJVKKT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |