C15H19N3OS — CID 131920585
3-ethyl-N-(2-ethylsulfanylphenyl)-1-methylpyrazole-5-carboxamide (PubChem CID 131920585) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 3-ethyl-N-(2-ethylsulfanylphenyl)-1-methylpyrazole-5-carboxamide.
| Compound Name | 3-ethyl-N-(2-ethylsulfanylphenyl)-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 131920585 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-ethyl-N-(2-ethylsulfanylphenyl)-1-methylpyrazole-5-carboxamide |
| SMILES | CCSc1ccccc1NC(=O)c1cc(CC)nn1C |
| InChI | InChI=1S/C15H19N3OS/c1-4-11-10-13(18(3)17-11)15(19)16-12-8-6-7-9-14(12)20-5-2/h6-10H,4-5H2,1-3H3,(H,16,19) |
| InChIKey | UXMYXJRNCBJPDF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |