C13H14FN3O3S — CID 116814053
2-[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]benzenesulfonyl fluoride (PubChem CID 116814053) has the molecular formula C13H14FN3O3S and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]benzenesulfonyl fluoride.
| Compound Name | 2-[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 116814053 |
| Molecular Formula | C13H14FN3O3S |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]benzenesulfonyl fluoride |
| SMILES | CCc1cc(C(=O)Nc2ccccc2S(=O)(=O)F)n(C)n1 |
| InChI | InChI=1S/C13H14FN3O3S/c1-3-9-8-11(17(2)16-9)13(18)15-10-6-4-5-7-12(10)21(14,19)20/h4-8H,3H2,1-2H3,(H,15,18) |
| InChIKey | CUXYUCUDRWEAIU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |