C13H26N2O3 — CID 131929418
(3S,4S)-1-(2-methyl-2-morpholin-4-ylpropyl)piperidine-3,4-diol (PubChem CID 131929418) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is (3S,4S)-1-(2-methyl-2-morpholin-4-ylpropyl)piperidine-3,4-diol.
| Compound Name | (3S,4S)-1-(2-methyl-2-morpholin-4-ylpropyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 131929418 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | (3S,4S)-1-(2-methyl-2-morpholin-4-ylpropyl)piperidine-3,4-diol |
| SMILES | CC(C)(CN1CC[C@H](O)[C@@H](O)C1)N1CCOCC1 |
| InChI | InChI=1S/C13H26N2O3/c1-13(2,15-5-7-18-8-6-15)10-14-4-3-11(16)12(17)9-14/h11-12,16-17H,3-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | JEZCIRMNMKBYPH-RYUDHWBXSA-N |
| XLogP | -0.48 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |