C11H22FNO — CID 138498136
(3R,4S)-1-(2,2-dimethylbutyl)-4-fluoropiperidin-3-ol (PubChem CID 138498136) has the molecular formula C11H22FNO and a molecular weight of 203.30 g/mol. Its IUPAC name is (3R,4S)-1-(2,2-dimethylbutyl)-4-fluoropiperidin-3-ol.
| Compound Name | (3R,4S)-1-(2,2-dimethylbutyl)-4-fluoropiperidin-3-ol |
|---|---|
| PubChem CID | 138498136 |
| Molecular Formula | C11H22FNO |
| Molecular Weight | 203.30 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (3R,4S)-1-(2,2-dimethylbutyl)-4-fluoropiperidin-3-ol |
| SMILES | CCC(C)(C)CN1CC[C@H](F)[C@H](O)C1 |
| InChI | InChI=1S/C11H22FNO/c1-4-11(2,3)8-13-6-5-9(12)10(14)7-13/h9-10,14H,4-8H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | UKLNPNVDGAHXLM-VHSXEESVSA-N |
| XLogP | 1.83 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |